C26H6F18 — CID 90327433
1,3,5,7,9,11-hexakis(trifluoromethyl)perylene (PubChem CID 90327433) has the molecular formula C26H6F18 and a molecular weight of 660.30 g/mol. Its IUPAC name is 1,3,5,7,9,11-hexakis(trifluoromethyl)perylene.
| Compound Name | 1,3,5,7,9,11-hexakis(trifluoromethyl)perylene |
|---|---|
| PubChem CID | 90327433 |
| Molecular Formula | C26H6F18 |
| Molecular Weight | 660.30 g/mol |
| Exact Mass | 660.02 |
| IUPAC Name | 1,3,5,7,9,11-hexakis(trifluoromethyl)perylene |
| SMILES | FC(F)(F)c1cc2c(C(F)(F)F)cc(C(F)(F)F)c3c4cc(C(F)(F)F)cc5c(C(F)(F)F)cc(C(F)(F)F)c(c(c1)c23)c54 |
| InChI | InChI=1S/C26H6F18/c27-21(28,29)7-1-9-13(23(33,34)35)5-15(25(39,40)41)19-12-4-8(22(30,31)32)2-10-14(24(36,37)38)6-16(26(42,43)44)20(18(10)12)11(3-7)17(9)19/h1-6H |
| InChIKey | ODNBLSMMNLKBML-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.30 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|