C10H5F6N3 — CID 175992502
6,8-bis(trifluoromethyl)quinazolin-4-amine (PubChem CID 175992502) has the molecular formula C10H5F6N3 and a molecular weight of 281.16 g/mol. Its IUPAC name is 6,8-bis(trifluoromethyl)quinazolin-4-amine.
| Compound Name | 6,8-bis(trifluoromethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 175992502 |
| Molecular Formula | C10H5F6N3 |
| Molecular Weight | 281.16 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 6,8-bis(trifluoromethyl)quinazolin-4-amine |
| SMILES | Nc1ncnc2c(C(F)(F)F)cc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C10H5F6N3/c11-9(12,13)4-1-5-7(18-3-19-8(5)17)6(2-4)10(14,15)16/h1-3H,(H2,17,18,19) |
| InChIKey | CEJQFCMBOQJLGW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.16 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |