C10H4F6N2 — CID 175829219
5,7-bis(trifluoromethyl)quinazoline (PubChem CID 175829219) has the molecular formula C10H4F6N2 and a molecular weight of 266.14 g/mol. Its IUPAC name is 5,7-bis(trifluoromethyl)quinazoline.
| Compound Name | 5,7-bis(trifluoromethyl)quinazoline |
|---|---|
| PubChem CID | 175829219 |
| Molecular Formula | C10H4F6N2 |
| Molecular Weight | 266.14 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 5,7-bis(trifluoromethyl)quinazoline |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)c2cncnc2c1 |
| InChI | InChI=1S/C10H4F6N2/c11-9(12,13)5-1-7(10(14,15)16)6-3-17-4-18-8(6)2-5/h1-4H |
| InChIKey | LDWYAYZKWRQCRG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.14 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |