C18H12F3N3 — CID 154455736
7-methyl-6-[2-(trifluoromethyl)phenyl]pyrrolo[3,2-f]quinazoline (PubChem CID 154455736) has the molecular formula C18H12F3N3 and a molecular weight of 327.31 g/mol. Its IUPAC name is 7-methyl-6-[2-(trifluoromethyl)phenyl]pyrrolo[3,2-f]quinazoline.
| Compound Name | 7-methyl-6-[2-(trifluoromethyl)phenyl]pyrrolo[3,2-f]quinazoline |
|---|---|
| PubChem CID | 154455736 |
| Molecular Formula | C18H12F3N3 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 7-methyl-6-[2-(trifluoromethyl)phenyl]pyrrolo[3,2-f]quinazoline |
| SMILES | Cn1ccc2c3cncnc3cc(-c3ccccc3C(F)(F)F)c21 |
| InChI | InChI=1S/C18H12F3N3/c1-24-7-6-12-14-9-22-10-23-16(14)8-13(17(12)24)11-4-2-3-5-15(11)18(19,20)21/h2-10H,1H3 |
| InChIKey | ITGVBLUZDLUEDD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |