C22H19F6N5O2 — CID 87716305
[1,3-diamino-2-ethyl-7-methyl-6-[2-(trifluoromethyl)phenyl]pyrrolo[3,2-f]quinazolin-1-yl] 2,2,2-trifluoroacetate (PubChem CID 87716305) has the molecular formula C22H19F6N5O2 and a molecular weight of 499.42 g/mol. Its IUPAC name is [1,3-diamino-2-ethyl-7-methyl-6-[2-(trifluoromethyl)phenyl]pyrrolo[3,2-f]quinazolin-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [1,3-diamino-2-ethyl-7-methyl-6-[2-(trifluoromethyl)phenyl]pyrrolo[3,2-f]quinazolin-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87716305 |
| Molecular Formula | C22H19F6N5O2 |
| Molecular Weight | 499.42 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | [1,3-diamino-2-ethyl-7-methyl-6-[2-(trifluoromethyl)phenyl]pyrrolo[3,2-f]quinazolin-1-yl] 2,2,2-trifluoroacetate |
| SMILES | CCN1C(N)=Nc2cc(-c3ccccc3C(F)(F)F)c3c(ccn3C)c2C1(N)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C22H19F6N5O2/c1-3-33-19(29)31-15-10-13(11-6-4-5-7-14(11)20(23,24)25)17-12(8-9-32(17)2)16(15)22(33,30)35-18(34)21(26,27)28/h4-10H,3,30H2,1-2H3,(H2,29,31) |
| InChIKey | ZFNRGFJAPDZBSQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 98.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|