C29H27AsF5N4O4P — CID 87724263
[[4-[2-[3-amino-1-dimethylarsanyl-6-[2-(trifluoromethyl)phenyl]pyrrolo[3,2-f]quinazolin-7-yl]ethoxymethyl]phenyl]-difluoromethyl]phosphonic acid (PubChem CID 87724263) has the molecular formula C29H27AsF5N4O4P and a molecular weight of 696.45 g/mol. Its IUPAC name is [[4-[2-[3-amino-1-dimethylarsanyl-6-[2-(trifluoromethyl)phenyl]pyrrolo[3,2-f]quinazolin-7-yl]ethoxymethyl]phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[4-[2-[3-amino-1-dimethylarsanyl-6-[2-(trifluoromethyl)phenyl]pyrrolo[3,2-f]quinazolin-7-yl]ethoxymethyl]phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 87724263 |
| Molecular Formula | C29H27AsF5N4O4P |
| Molecular Weight | 696.45 g/mol |
| Exact Mass | 696.09 |
| IUPAC Name | [[4-[2-[3-amino-1-dimethylarsanyl-6-[2-(trifluoromethyl)phenyl]pyrrolo[3,2-f]quinazolin-7-yl]ethoxymethyl]phenyl]-difluoromethyl]phosphonic acid |
| SMILES | C[As](C)c1nc(N)nc2cc(-c3ccccc3C(F)(F)F)c3c(ccn3CCOCc3ccc(C(F)(F)P(=O)(O)O)cc3)c12 |
| InChI | InChI=1S/C29H27AsF5N4O4P/c1-30(2)26-24-20-11-12-39(13-14-43-16-17-7-9-18(10-8-17)29(34,35)44(40,41)42)25(20)21(15-23(24)37-27(36)38-26)19-5-3-4-6-22(19)28(31,32)33/h3-12,15H,13-14,16H2,1-2H3,(H2,36,37,38)(H2,40,41,42) |
| InChIKey | JGJKOAVMOGFYHU-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.45 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|