C30H29F3IN5O4 — CID 69154331
[1,3-diamino-6-iodo-2,7-bis(2-phenylmethoxyethyl)pyrrolo[3,2-f]quinazolin-1-yl] 2,2,2-trifluoroacetate (PubChem CID 69154331) has the molecular formula C30H29F3IN5O4 and a molecular weight of 707.49 g/mol. Its IUPAC name is [1,3-diamino-6-iodo-2,7-bis(2-phenylmethoxyethyl)pyrrolo[3,2-f]quinazolin-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [1,3-diamino-6-iodo-2,7-bis(2-phenylmethoxyethyl)pyrrolo[3,2-f]quinazolin-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 69154331 |
| Molecular Formula | C30H29F3IN5O4 |
| Molecular Weight | 707.49 g/mol |
| Exact Mass | 707.12 |
| IUPAC Name | [1,3-diamino-6-iodo-2,7-bis(2-phenylmethoxyethyl)pyrrolo[3,2-f]quinazolin-1-yl] 2,2,2-trifluoroacetate |
| SMILES | NC1=Nc2cc(I)c3c(ccn3CCOCc3ccccc3)c2C(N)(OC(=O)C(F)(F)F)N1CCOCc1ccccc1 |
| InChI | InChI=1S/C30H29F3IN5O4/c31-29(32,33)27(40)43-30(36)25-22-11-12-38(13-15-41-18-20-7-3-1-4-8-20)26(22)23(34)17-24(25)37-28(35)39(30)14-16-42-19-21-9-5-2-6-10-21/h1-12,17H,13-16,18-19,36H2,(H2,35,37) |
| InChIKey | UDXGWJJKDGFQFR-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 117.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.49 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|