C31H26F3N3O4 — CID 68969897
[2-amino-1-methyl-5-oxo-4-phenyl-4-[3-(4-phenylmethoxyphenyl)phenyl]imidazolidin-2-yl] 2,2,2-trifluoroacetate (PubChem CID 68969897) has the molecular formula C31H26F3N3O4 and a molecular weight of 561.56 g/mol. Its IUPAC name is [2-amino-1-methyl-5-oxo-4-phenyl-4-[3-(4-phenylmethoxyphenyl)phenyl]imidazolidin-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [2-amino-1-methyl-5-oxo-4-phenyl-4-[3-(4-phenylmethoxyphenyl)phenyl]imidazolidin-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68969897 |
| Molecular Formula | C31H26F3N3O4 |
| Molecular Weight | 561.56 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | [2-amino-1-methyl-5-oxo-4-phenyl-4-[3-(4-phenylmethoxyphenyl)phenyl]imidazolidin-2-yl] 2,2,2-trifluoroacetate |
| SMILES | CN1C(=O)C(c2ccccc2)(c2cccc(-c3ccc(OCc4ccccc4)cc3)c2)NC1(N)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C31H26F3N3O4/c1-37-27(38)29(24-12-6-3-7-13-24,36-31(37,35)41-28(39)30(32,33)34)25-14-8-11-23(19-25)22-15-17-26(18-16-22)40-20-21-9-4-2-5-10-21/h2-19,36H,20,35H2,1H3 |
| InChIKey | XXTQDMMLJNWAID-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|