C29H27F3N2O4S — CID 174214288
4-methyl-N-(4-methylsulfonylphenyl)-1-(2-phenylmethoxyethyl)-5-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide (PubChem CID 174214288) has the molecular formula C29H27F3N2O4S and a molecular weight of 556.61 g/mol. Its IUPAC name is 4-methyl-N-(4-methylsulfonylphenyl)-1-(2-phenylmethoxyethyl)-5-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide.
| Compound Name | 4-methyl-N-(4-methylsulfonylphenyl)-1-(2-phenylmethoxyethyl)-5-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 174214288 |
| Molecular Formula | C29H27F3N2O4S |
| Molecular Weight | 556.61 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | 4-methyl-N-(4-methylsulfonylphenyl)-1-(2-phenylmethoxyethyl)-5-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(S(C)(=O)=O)cc2)cn(CCOCc2ccccc2)c1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C29H27F3N2O4S/c1-20-25(28(35)33-22-12-14-23(15-13-22)39(2,36)37)18-34(16-17-38-19-21-8-4-3-5-9-21)27(20)24-10-6-7-11-26(24)29(30,31)32/h3-15,18H,16-17,19H2,1-2H3,(H,33,35) |
| InChIKey | RMBBJOHTYUBDEF-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.61 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|