C22H19F3N3O4S- — CID 174693478
[4-[[1-(2-amino-2-oxoethyl)-4-methyl-5-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]phenyl]methanesulfinate (PubChem CID 174693478) has the molecular formula C22H19F3N3O4S- and a molecular weight of 478.47 g/mol. Its IUPAC name is [4-[[1-(2-amino-2-oxoethyl)-4-methyl-5-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]phenyl]methanesulfinate.
| Compound Name | [4-[[1-(2-amino-2-oxoethyl)-4-methyl-5-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174693478 |
| Molecular Formula | C22H19F3N3O4S- |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | [4-[[1-(2-amino-2-oxoethyl)-4-methyl-5-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]phenyl]methanesulfinate |
| SMILES | Cc1c(C(=O)Nc2ccc(CS(=O)[O-])cc2)cn(CC(N)=O)c1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C22H20F3N3O4S/c1-13-17(21(30)27-15-8-6-14(7-9-15)12-33(31)32)10-28(11-19(26)29)20(13)16-4-2-3-5-18(16)22(23,24)25/h2-10H,11-12H2,1H3,(H2,26,29)(H,27,30)(H,31,32)/p-1 |
| InChIKey | KODVSOHFFSCQTN-UHFFFAOYSA-M |
| XLogP | 3.60 |
| TPSA | 117.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|