C24H25F3N2O4S — CID 58538835
1-(4-hydroxybutyl)-4-methyl-N-(4-methylsulfonylphenyl)-5-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide (PubChem CID 58538835) has the molecular formula C24H25F3N2O4S and a molecular weight of 494.54 g/mol. Its IUPAC name is 1-(4-hydroxybutyl)-4-methyl-N-(4-methylsulfonylphenyl)-5-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide.
| Compound Name | 1-(4-hydroxybutyl)-4-methyl-N-(4-methylsulfonylphenyl)-5-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 58538835 |
| Molecular Formula | C24H25F3N2O4S |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | 1-(4-hydroxybutyl)-4-methyl-N-(4-methylsulfonylphenyl)-5-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(S(C)(=O)=O)cc2)cn(CCCCO)c1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C24H25F3N2O4S/c1-16-20(23(31)28-17-9-11-18(12-10-17)34(2,32)33)15-29(13-5-6-14-30)22(16)19-7-3-4-8-21(19)24(25,26)27/h3-4,7-12,15,30H,5-6,13-14H2,1-2H3,(H,28,31) |
| InChIKey | HYWBIXLFQBAOEJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|