C26H28F3N3O4S — CID 174693474
[4-[[1-[2-(butylamino)-2-oxoethyl]-4-methyl-5-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]phenyl]methanesulfinic acid (PubChem CID 174693474) has the molecular formula C26H28F3N3O4S and a molecular weight of 535.59 g/mol. Its IUPAC name is [4-[[1-[2-(butylamino)-2-oxoethyl]-4-methyl-5-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]phenyl]methanesulfinic acid.
| Compound Name | [4-[[1-[2-(butylamino)-2-oxoethyl]-4-methyl-5-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174693474 |
| Molecular Formula | C26H28F3N3O4S |
| Molecular Weight | 535.59 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | [4-[[1-[2-(butylamino)-2-oxoethyl]-4-methyl-5-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]phenyl]methanesulfinic acid |
| SMILES | CCCCNC(=O)Cn1cc(C(=O)Nc2ccc(CS(=O)O)cc2)c(C)c1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C26H28F3N3O4S/c1-3-4-13-30-23(33)15-32-14-21(25(34)31-19-11-9-18(10-12-19)16-37(35)36)17(2)24(32)20-7-5-6-8-22(20)26(27,28)29/h5-12,14H,3-4,13,15-16H2,1-2H3,(H,30,33)(H,31,34)(H,35,36) |
| InChIKey | MVKOEHCMNAYKRO-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.59 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|