C23H23F3N2O — CID 59808020
2,5-dimethyl-N-(4-propylphenyl)-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide (PubChem CID 59808020) has the molecular formula C23H23F3N2O and a molecular weight of 400.44 g/mol. Its IUPAC name is 2,5-dimethyl-N-(4-propylphenyl)-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide.
| Compound Name | 2,5-dimethyl-N-(4-propylphenyl)-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 59808020 |
| Molecular Formula | C23H23F3N2O |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 2,5-dimethyl-N-(4-propylphenyl)-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
| SMILES | CCCc1ccc(NC(=O)c2cc(C)n(-c3ccccc3C(F)(F)F)c2C)cc1 |
| InChI | InChI=1S/C23H23F3N2O/c1-4-7-17-10-12-18(13-11-17)27-22(29)19-14-15(2)28(16(19)3)21-9-6-5-8-20(21)23(24,25)26/h5-6,8-14H,4,7H2,1-3H3,(H,27,29) |
| InChIKey | LFMBHLFBAAGKRX-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|