C11H6F3N3S — CID 154276626
8-(trifluoromethyl)-[1]benzothiolo[3,2-d]pyrimidin-4-amine (PubChem CID 154276626) has the molecular formula C11H6F3N3S and a molecular weight of 269.25 g/mol. Its IUPAC name is 8-(trifluoromethyl)-[1]benzothiolo[3,2-d]pyrimidin-4-amine.
| Compound Name | 8-(trifluoromethyl)-[1]benzothiolo[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 154276626 |
| Molecular Formula | C11H6F3N3S |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | 8-(trifluoromethyl)-[1]benzothiolo[3,2-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2c1sc1ccc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C11H6F3N3S/c12-11(13,14)5-1-2-7-6(3-5)8-9(18-7)10(15)17-4-16-8/h1-4H,(H2,15,16,17) |
| InChIKey | UUQNLQTXGHTEAD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |