About 5-[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]-1,3-benzothiazole-2,4-diamine
5-[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]-1,3-benzothiazole-2,4-diamine (PubChem CID 22135546) has the molecular formula C18H12F3N5S
and a molecular weight of 387.39 g/mol. Its IUPAC name is 5-[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]-1,3-benzothiazole-2,4-diamine.
Molecular Properties
| Compound Name | 5-[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]-1,3-benzothiazole-2,4-diamine |
| PubChem CID | 22135546 |
| Molecular Formula | C18H12F3N5S |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 5-[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]-1,3-benzothiazole-2,4-diamine |
| SMILES | Nc1nc2c(N)c(-c3cc(-c4ccc(C(F)(F)F)cc4)ncn3)ccc2s1 |
| InChI | InChI=1S/C18H12F3N5S/c19-18(20,21)10-3-1-9(2-4-10)12-7-13(25-8-24-12)11-5-6-14-16(15(11)22)26-17(23)27-14/h1-8H,22H2,(H2,23,26) |
| InChIKey | QCGIMDYKBZTGBH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]-1,3-benzothiazole-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]-1,3-benzothiazole-2,4-diamine?
The IUPAC name of 5-[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]-1,3-benzothiazole-2,4-diamine (CID 22135546) is 5-[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]-1,3-benzothiazole-2,4-diamine.
What is the SMILES notation for 5-[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]-1,3-benzothiazole-2,4-diamine?
The canonical SMILES for 5-[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]-1,3-benzothiazole-2,4-diamine is Nc1nc2c(N)c(-c3cc(-c4ccc(C(F)(F)F)cc4)ncn3)ccc2s1.
What is the InChIKey of 5-[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]-1,3-benzothiazole-2,4-diamine?
The InChIKey is QCGIMDYKBZTGBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12F3N5S/c19-18(20,21)10-3-1-9(2-4-10)12-7-13(25-8-24-12)11-5-6-14-16(15(11)22)26-17(23)27-14/h1-8H,22H2,(H2,23,26).
What are the key properties of 5-[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]-1,3-benzothiazole-2,4-diamine?
5-[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]-1,3-benzothiazole-2,4-diamine has a molecular weight of 387.39 g/mol, XLogP of 4.60, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]-1,3-benzothiazole-2,4-diamine is sourced from PubChem (CID 22135546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).