C14H9F3N2OS — CID 87736788
2-(2-amino-1,3-benzothiazol-4-yl)-5-(trifluoromethyl)phenol (PubChem CID 87736788) has the molecular formula C14H9F3N2OS and a molecular weight of 310.30 g/mol. Its IUPAC name is 2-(2-amino-1,3-benzothiazol-4-yl)-5-(trifluoromethyl)phenol.
| Compound Name | 2-(2-amino-1,3-benzothiazol-4-yl)-5-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 87736788 |
| Molecular Formula | C14H9F3N2OS |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 2-(2-amino-1,3-benzothiazol-4-yl)-5-(trifluoromethyl)phenol |
| SMILES | Nc1nc2c(-c3ccc(C(F)(F)F)cc3O)cccc2s1 |
| InChI | InChI=1S/C14H9F3N2OS/c15-14(16,17)7-4-5-8(10(20)6-7)9-2-1-3-11-12(9)19-13(18)21-11/h1-6,20H,(H2,18,19) |
| InChIKey | DISPFAFHGDADKR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |