C15H9F3N6O2S2 — CID 123902771
3-(2-amino-1,3-benzothiazol-4-yl)-2-(2H-tetrazol-5-yl)-6-(trifluoromethyl)benzenesulfinic acid (PubChem CID 123902771) has the molecular formula C15H9F3N6O2S2 and a molecular weight of 426.41 g/mol. Its IUPAC name is 3-(2-amino-1,3-benzothiazol-4-yl)-2-(2H-tetrazol-5-yl)-6-(trifluoromethyl)benzenesulfinic acid.
| Compound Name | 3-(2-amino-1,3-benzothiazol-4-yl)-2-(2H-tetrazol-5-yl)-6-(trifluoromethyl)benzenesulfinic acid |
|---|---|
| PubChem CID | 123902771 |
| Molecular Formula | C15H9F3N6O2S2 |
| Molecular Weight | 426.41 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | 3-(2-amino-1,3-benzothiazol-4-yl)-2-(2H-tetrazol-5-yl)-6-(trifluoromethyl)benzenesulfinic acid |
| SMILES | Nc1nc2c(-c3ccc(C(F)(F)F)c(S(=O)O)c3-c3nn[nH]n3)cccc2s1 |
| InChI | InChI=1S/C15H9F3N6O2S2/c16-15(17,18)8-5-4-6(7-2-1-3-9-11(7)20-14(19)27-9)10(12(8)28(25)26)13-21-23-24-22-13/h1-5H,(H2,19,20)(H,25,26)(H,21,22,23,24) |
| InChIKey | VEKNMYWNIGGZGZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|