C45H18F27N — CID 59711273
4-[2,4,6-tris(trifluoromethyl)phenyl]-N,N-bis[4-[2,4,6-tris(trifluoromethyl)phenyl]phenyl]aniline (PubChem CID 59711273) has the molecular formula C45H18F27N and a molecular weight of 1085.59 g/mol. Its IUPAC name is 4-[2,4,6-tris(trifluoromethyl)phenyl]-N,N-bis[4-[2,4,6-tris(trifluoromethyl)phenyl]phenyl]aniline.
| Compound Name | 4-[2,4,6-tris(trifluoromethyl)phenyl]-N,N-bis[4-[2,4,6-tris(trifluoromethyl)phenyl]phenyl]aniline |
|---|---|
| PubChem CID | 59711273 |
| Molecular Formula | C45H18F27N |
| Molecular Weight | 1085.59 g/mol |
| Exact Mass | 1085.10 |
| IUPAC Name | 4-[2,4,6-tris(trifluoromethyl)phenyl]-N,N-bis[4-[2,4,6-tris(trifluoromethyl)phenyl]phenyl]aniline |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)c(-c2ccc(N(c3ccc(-c4c(C(F)(F)F)cc(C(F)(F)F)cc4C(F)(F)F)cc3)c3ccc(-c4c(C(F)(F)F)cc(C(F)(F)F)cc4C(F)(F)F)cc3)cc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C45H18F27N/c46-37(47,48)22-13-28(40(55,56)57)34(29(14-22)41(58,59)60)19-1-7-25(8-2-19)73(26-9-3-20(4-10-26)35-30(42(61,62)63)15-23(38(49,50)51)16-31(35)43(64,65)66)27-11-5-21(6-12-27)36-32(44(67,68)69)17-24(39(52,53)54)18-33(36)45(70,71)72/h1-18H |
| InChIKey | YYMNEPZRQXAKFX-UHFFFAOYSA-N |
| XLogP | 19.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1085.59 |
| LogP ≤ 5 | 19.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |