C16H9F6NO4 — CID 170561578
carboxy-[2-phenyl-3,5-bis(trifluoromethyl)phenyl]carbamic acid (PubChem CID 170561578) has the molecular formula C16H9F6NO4 and a molecular weight of 393.24 g/mol. Its IUPAC name is carboxy-[2-phenyl-3,5-bis(trifluoromethyl)phenyl]carbamic acid.
| Compound Name | carboxy-[2-phenyl-3,5-bis(trifluoromethyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 170561578 |
| Molecular Formula | C16H9F6NO4 |
| Molecular Weight | 393.24 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | carboxy-[2-phenyl-3,5-bis(trifluoromethyl)phenyl]carbamic acid |
| SMILES | O=C(O)N(C(=O)O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1-c1ccccc1 |
| InChI | InChI=1S/C16H9F6NO4/c17-15(18,19)9-6-10(16(20,21)22)12(8-4-2-1-3-5-8)11(7-9)23(13(24)25)14(26)27/h1-7H,(H,24,25)(H,26,27) |
| InChIKey | CJEJFUIHVQIDJQ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.24 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |