About 2-phenyl-3,5-bis(trifluoromethyl)naphthalen-1-ol
2-phenyl-3,5-bis(trifluoromethyl)naphthalen-1-ol (PubChem CID 57017238) has the molecular formula C18H10F6O
and a molecular weight of 356.27 g/mol. Its IUPAC name is 2-phenyl-3,5-bis(trifluoromethyl)naphthalen-1-ol.
Molecular Properties
| Compound Name | 2-phenyl-3,5-bis(trifluoromethyl)naphthalen-1-ol |
| PubChem CID | 57017238 |
| Molecular Formula | C18H10F6O |
| Molecular Weight | 356.27 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 2-phenyl-3,5-bis(trifluoromethyl)naphthalen-1-ol |
| SMILES | Oc1c(-c2ccccc2)c(C(F)(F)F)cc2c(C(F)(F)F)cccc12 |
| InChI | InChI=1S/C18H10F6O/c19-17(20,21)13-8-4-7-11-12(13)9-14(18(22,23)24)15(16(11)25)10-5-2-1-3-6-10/h1-9,25H |
| InChIKey | RCTRVKPZSPFQOM-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.27 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-phenyl-3,5-bis(trifluoromethyl)naphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-3,5-bis(trifluoromethyl)naphthalen-1-ol?
The IUPAC name of 2-phenyl-3,5-bis(trifluoromethyl)naphthalen-1-ol (CID 57017238) is 2-phenyl-3,5-bis(trifluoromethyl)naphthalen-1-ol.
What is the SMILES notation for 2-phenyl-3,5-bis(trifluoromethyl)naphthalen-1-ol?
The canonical SMILES for 2-phenyl-3,5-bis(trifluoromethyl)naphthalen-1-ol is Oc1c(-c2ccccc2)c(C(F)(F)F)cc2c(C(F)(F)F)cccc12.
What is the InChIKey of 2-phenyl-3,5-bis(trifluoromethyl)naphthalen-1-ol?
The InChIKey is RCTRVKPZSPFQOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10F6O/c19-17(20,21)13-8-4-7-11-12(13)9-14(18(22,23)24)15(16(11)25)10-5-2-1-3-6-10/h1-9,25H.
What are the key properties of 2-phenyl-3,5-bis(trifluoromethyl)naphthalen-1-ol?
2-phenyl-3,5-bis(trifluoromethyl)naphthalen-1-ol has a molecular weight of 356.27 g/mol, XLogP of 6.25, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-3,5-bis(trifluoromethyl)naphthalen-1-ol is sourced from PubChem (CID 57017238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).