C18H10F6O — CID 57017238
2-phenyl-3,5-bis(trifluoromethyl)naphthalen-1-ol (PubChem CID 57017238) has the molecular formula C18H10F6O and a molecular weight of 356.27 g/mol. Its IUPAC name is 2-phenyl-3,5-bis(trifluoromethyl)naphthalen-1-ol.
| Compound Name | 2-phenyl-3,5-bis(trifluoromethyl)naphthalen-1-ol |
|---|---|
| PubChem CID | 57017238 |
| Molecular Formula | C18H10F6O |
| Molecular Weight | 356.27 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 2-phenyl-3,5-bis(trifluoromethyl)naphthalen-1-ol |
| SMILES | Oc1c(-c2ccccc2)c(C(F)(F)F)cc2c(C(F)(F)F)cccc12 |
| InChI | InChI=1S/C18H10F6O/c19-17(20,21)13-8-4-7-11-12(13)9-14(18(22,23)24)15(16(11)25)10-5-2-1-3-6-10/h1-9,25H |
| InChIKey | RCTRVKPZSPFQOM-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.27 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |