C18H11NO4 — CID 91824339
4,6-dihydroxy-5-phenylbenzo[de]isoquinoline-1,3-dione (PubChem CID 91824339) has the molecular formula C18H11NO4 and a molecular weight of 305.29 g/mol. Its IUPAC name is 4,6-dihydroxy-5-phenylbenzo[de]isoquinoline-1,3-dione.
| Compound Name | 4,6-dihydroxy-5-phenylbenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 91824339 |
| Molecular Formula | C18H11NO4 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 4,6-dihydroxy-5-phenylbenzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1NC(=O)c2c(O)c(-c3ccccc3)c(O)c3cccc1c23 |
| InChI | InChI=1S/C18H11NO4/c20-15-10-7-4-8-11-13(10)14(18(23)19-17(11)22)16(21)12(15)9-5-2-1-3-6-9/h1-8,20-21H,(H,19,22,23) |
| InChIKey | JKRWEUNINHVXFZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|