C22H17O5P — CID 69204256
(5,8-dihydroxy-6,7-diphenylnaphthalen-1-yl)phosphonic acid (PubChem CID 69204256) has the molecular formula C22H17O5P and a molecular weight of 392.35 g/mol. Its IUPAC name is (5,8-dihydroxy-6,7-diphenylnaphthalen-1-yl)phosphonic acid.
| Compound Name | (5,8-dihydroxy-6,7-diphenylnaphthalen-1-yl)phosphonic acid |
|---|---|
| PubChem CID | 69204256 |
| Molecular Formula | C22H17O5P |
| Molecular Weight | 392.35 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | (5,8-dihydroxy-6,7-diphenylnaphthalen-1-yl)phosphonic acid |
| SMILES | O=P(O)(O)c1cccc2c(O)c(-c3ccccc3)c(-c3ccccc3)c(O)c12 |
| InChI | InChI=1S/C22H17O5P/c23-21-16-12-7-13-17(28(25,26)27)20(16)22(24)19(15-10-5-2-6-11-15)18(21)14-8-3-1-4-9-14/h1-13,23-24H,(H2,25,26,27) |
| InChIKey | RRXZWOLABBLKPE-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.35 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|