About naphthalen-1-ylphosphonic acid;dihydrochloride
naphthalen-1-ylphosphonic acid;dihydrochloride (PubChem CID 175207516) has the molecular formula C10H11Cl2O3P
and a molecular weight of 281.08 g/mol. Its IUPAC name is naphthalen-1-ylphosphonic acid;dihydrochloride.
Molecular Properties
| Compound Name | naphthalen-1-ylphosphonic acid;dihydrochloride |
| PubChem CID | 175207516 |
| Molecular Formula | C10H11Cl2O3P |
| Molecular Weight | 281.08 g/mol |
| Exact Mass | 279.98 |
| IUPAC Name | naphthalen-1-ylphosphonic acid;dihydrochloride |
| SMILES | Cl.Cl.O=P(O)(O)c1cccc2ccccc12 |
| InChI | InChI=1S/C10H9O3P.2ClH/c11-14(12,13)10-7-3-5-8-4-1-2-6-9(8)10;;/h1-7H,(H2,11,12,13);2*1H |
| InChIKey | TUAJJFHAFCCTNE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.08 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-1-ylphosphonic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-1-ylphosphonic acid;dihydrochloride?
The IUPAC name of naphthalen-1-ylphosphonic acid;dihydrochloride (CID 175207516) is naphthalen-1-ylphosphonic acid;dihydrochloride.
What is the SMILES notation for naphthalen-1-ylphosphonic acid;dihydrochloride?
The canonical SMILES for naphthalen-1-ylphosphonic acid;dihydrochloride is Cl.Cl.O=P(O)(O)c1cccc2ccccc12.
What is the InChIKey of naphthalen-1-ylphosphonic acid;dihydrochloride?
The InChIKey is TUAJJFHAFCCTNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9O3P.2ClH/c11-14(12,13)10-7-3-5-8-4-1-2-6-9(8)10;;/h1-7H,(H2,11,12,13);2*1H.
What are the key properties of naphthalen-1-ylphosphonic acid;dihydrochloride?
naphthalen-1-ylphosphonic acid;dihydrochloride has a molecular weight of 281.08 g/mol, XLogP of 2.49, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-1-ylphosphonic acid;dihydrochloride is sourced from PubChem (CID 175207516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).