C44H34N2O2P2 — CID 139920617
2-N,3-N-bis(dinaphthalen-1-ylphosphoryl)butane-2,3-diimine (PubChem CID 139920617) has the molecular formula C44H34N2O2P2 and a molecular weight of 684.72 g/mol. Its IUPAC name is 2-N,3-N-bis(dinaphthalen-1-ylphosphoryl)butane-2,3-diimine.
| Compound Name | 2-N,3-N-bis(dinaphthalen-1-ylphosphoryl)butane-2,3-diimine |
|---|---|
| PubChem CID | 139920617 |
| Molecular Formula | C44H34N2O2P2 |
| Molecular Weight | 684.72 g/mol |
| Exact Mass | 684.21 |
| IUPAC Name | 2-N,3-N-bis(dinaphthalen-1-ylphosphoryl)butane-2,3-diimine |
| SMILES | CC(=NP(=O)(c1cccc2ccccc12)c1cccc2ccccc12)C(C)=NP(=O)(c1cccc2ccccc12)c1cccc2ccccc12 |
| InChI | InChI=1S/C44H34N2O2P2/c1-31(45-49(47,41-27-11-19-33-15-3-7-23-37(33)41)42-28-12-20-34-16-4-8-24-38(34)42)32(2)46-50(48,43-29-13-21-35-17-5-9-25-39(35)43)44-30-14-22-36-18-6-10-26-40(36)44/h3-30H,1-2H3 |
| InChIKey | OPFNZLUXJGUBNY-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.72 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|