C17H15O3P — CID 54108452
(4-methoxyphenyl)-naphthalen-1-ylphosphinic acid (PubChem CID 54108452) has the molecular formula C17H15O3P and a molecular weight of 298.28 g/mol. Its IUPAC name is (4-methoxyphenyl)-naphthalen-1-ylphosphinic acid.
| Compound Name | (4-methoxyphenyl)-naphthalen-1-ylphosphinic acid |
|---|---|
| PubChem CID | 54108452 |
| Molecular Formula | C17H15O3P |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | (4-methoxyphenyl)-naphthalen-1-ylphosphinic acid |
| SMILES | COc1ccc(P(=O)(O)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C17H15O3P/c1-20-14-9-11-15(12-10-14)21(18,19)17-8-4-6-13-5-2-3-7-16(13)17/h2-12H,1H3,(H,18,19) |
| InChIKey | NFJXFFAHCZRLPM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|