C14H18NO4P — CID 44889970
(4-methoxyphenyl)phosphonic acid;phenylmethanamine (PubChem CID 44889970) has the molecular formula C14H18NO4P and a molecular weight of 295.28 g/mol. Its IUPAC name is (4-methoxyphenyl)phosphonic acid;phenylmethanamine.
| Compound Name | (4-methoxyphenyl)phosphonic acid;phenylmethanamine |
|---|---|
| PubChem CID | 44889970 |
| Molecular Formula | C14H18NO4P |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | (4-methoxyphenyl)phosphonic acid;phenylmethanamine |
| SMILES | COc1ccc(P(=O)(O)O)cc1.NCc1ccccc1 |
| InChI | InChI=1S/C7H9N.C7H9O4P/c8-6-7-4-2-1-3-5-7;1-11-6-2-4-7(5-3-6)12(8,9)10/h1-5H,6,8H2;2-5H,1H3,(H2,8,9,10) |
| InChIKey | JPKWKNPLGAHVRD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|