About [3-(aminomethyl)phenyl]methanamine;phenol;phosphoric acid
[3-(aminomethyl)phenyl]methanamine;phenol;phosphoric acid (PubChem CID 67041954) has the molecular formula C14H21N2O5P
and a molecular weight of 328.31 g/mol. Its IUPAC name is [3-(aminomethyl)phenyl]methanamine;phenol;phosphoric acid.
Molecular Properties
| Compound Name | [3-(aminomethyl)phenyl]methanamine;phenol;phosphoric acid |
| PubChem CID | 67041954 |
| Molecular Formula | C14H21N2O5P |
| Molecular Weight | 328.31 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | [3-(aminomethyl)phenyl]methanamine;phenol;phosphoric acid |
| SMILES | NCc1cccc(CN)c1.O=P(O)(O)O.Oc1ccccc1 |
| InChI | InChI=1S/C8H12N2.C6H6O.H3O4P/c9-5-7-2-1-3-8(4-7)6-10;7-6-4-2-1-3-5-6;1-5(2,3)4/h1-4H,5-6,9-10H2;1-5,7H;(H3,1,2,3,4) |
| InChIKey | CUAIRZJYZYJCIX-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [3-(aminomethyl)phenyl]methanamine;phenol;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(aminomethyl)phenyl]methanamine;phenol;phosphoric acid?
The IUPAC name of [3-(aminomethyl)phenyl]methanamine;phenol;phosphoric acid (CID 67041954) is [3-(aminomethyl)phenyl]methanamine;phenol;phosphoric acid.
What is the SMILES notation for [3-(aminomethyl)phenyl]methanamine;phenol;phosphoric acid?
The canonical SMILES for [3-(aminomethyl)phenyl]methanamine;phenol;phosphoric acid is NCc1cccc(CN)c1.O=P(O)(O)O.Oc1ccccc1.
What is the InChIKey of [3-(aminomethyl)phenyl]methanamine;phenol;phosphoric acid?
The InChIKey is CUAIRZJYZYJCIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2.C6H6O.H3O4P/c9-5-7-2-1-3-8(4-7)6-10;7-6-4-2-1-3-5-6;1-5(2,3)4/h1-4H,5-6,9-10H2;1-5,7H;(H3,1,2,3,4).
What are the key properties of [3-(aminomethyl)phenyl]methanamine;phenol;phosphoric acid?
[3-(aminomethyl)phenyl]methanamine;phenol;phosphoric acid has a molecular weight of 328.31 g/mol, XLogP of 1.07, 2 rotatable bonds, 6 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(aminomethyl)phenyl]methanamine;phenol;phosphoric acid is sourced from PubChem (CID 67041954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).