C7H7O4P-2 — CID 7004098
(4-methoxyphenyl)-dioxido-oxo-λ5-phosphane (PubChem CID 7004098) has the molecular formula C7H7O4P-2 and a molecular weight of 186.10 g/mol. Its IUPAC name is (4-methoxyphenyl)-dioxido-oxo-λ5-phosphane.
| Compound Name | (4-methoxyphenyl)-dioxido-oxo-λ5-phosphane |
|---|---|
| PubChem CID | 7004098 |
| Molecular Formula | C7H7O4P-2 |
| Molecular Weight | 186.10 g/mol |
| Exact Mass | 186.01 |
| IUPAC Name | (4-methoxyphenyl)-dioxido-oxo-λ5-phosphane |
| SMILES | COc1ccc(P(=O)([O-])[O-])cc1 |
| InChI | InChI=1S/C7H9O4P/c1-11-6-2-4-7(5-3-6)12(8,9)10/h2-5H,1H3,(H2,8,9,10)/p-2 |
| InChIKey | SCMAYTUWDLAAAO-UHFFFAOYSA-L |
| XLogP | -0.77 |
| TPSA | 72.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.10 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|