C16H26N2O9P2 — CID 139085147
[hydroxy(oxido)phosphoryl] hydrogen phosphate;bis((4-methoxyphenyl)methylazanium) (PubChem CID 139085147) has the molecular formula C16H26N2O9P2 and a molecular weight of 452.34 g/mol. Its IUPAC name is [hydroxy(oxido)phosphoryl] hydrogen phosphate;bis((4-methoxyphenyl)methylazanium).
| Compound Name | [hydroxy(oxido)phosphoryl] hydrogen phosphate;bis((4-methoxyphenyl)methylazanium) |
|---|---|
| PubChem CID | 139085147 |
| Molecular Formula | C16H26N2O9P2 |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | [hydroxy(oxido)phosphoryl] hydrogen phosphate;bis((4-methoxyphenyl)methylazanium) |
| SMILES | COc1ccc(C[NH3+])cc1.COc1ccc(C[NH3+])cc1.O=P([O-])(O)OP(=O)([O-])O |
| InChI | InChI=1S/2C8H11NO.H4O7P2/c2*1-10-8-4-2-7(6-9)3-5-8;1-8(2,3)7-9(4,5)6/h2*2-5H,6,9H2,1H3;(H2,1,2,3)(H2,4,5,6) |
| InChIKey | WTWXTNQMYLMHNR-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 203.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|