C19H24NO6P — CID 160796333
4-acetamidobutanoic acid;(4-methoxyphenyl)-phenylphosphinic acid (PubChem CID 160796333) has the molecular formula C19H24NO6P and a molecular weight of 393.38 g/mol. Its IUPAC name is 4-acetamidobutanoic acid;(4-methoxyphenyl)-phenylphosphinic acid.
| Compound Name | 4-acetamidobutanoic acid;(4-methoxyphenyl)-phenylphosphinic acid |
|---|---|
| PubChem CID | 160796333 |
| Molecular Formula | C19H24NO6P |
| Molecular Weight | 393.38 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 4-acetamidobutanoic acid;(4-methoxyphenyl)-phenylphosphinic acid |
| SMILES | CC(=O)NCCCC(=O)O.COc1ccc(P(=O)(O)c2ccccc2)cc1 |
| InChI | InChI=1S/C13H13O3P.C6H11NO3/c1-16-11-7-9-13(10-8-11)17(14,15)12-5-3-2-4-6-12;1-5(8)7-4-2-3-6(9)10/h2-10H,1H3,(H,14,15);2-4H2,1H3,(H,7,8)(H,9,10) |
| InChIKey | SCMLEKOZZFXQQJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|