C24H9BF18 — CID 132564251
phenyl-bis[2,4,6-tris(trifluoromethyl)phenyl]borane (PubChem CID 132564251) has the molecular formula C24H9BF18 and a molecular weight of 650.11 g/mol. Its IUPAC name is phenyl-bis[2,4,6-tris(trifluoromethyl)phenyl]borane.
| Compound Name | phenyl-bis[2,4,6-tris(trifluoromethyl)phenyl]borane |
|---|---|
| PubChem CID | 132564251 |
| Molecular Formula | C24H9BF18 |
| Molecular Weight | 650.11 g/mol |
| Exact Mass | 650.05 |
| IUPAC Name | phenyl-bis[2,4,6-tris(trifluoromethyl)phenyl]borane |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)c(B(c2ccccc2)c2c(C(F)(F)F)cc(C(F)(F)F)cc2C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H9BF18/c26-19(27,28)10-6-13(21(32,33)34)17(14(7-10)22(35,36)37)25(12-4-2-1-3-5-12)18-15(23(38,39)40)8-11(20(29,30)31)9-16(18)24(41,42)43/h1-9H |
| InChIKey | MODTUGAKJWQVJR-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.11 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|