C56H36B2F18 — CID 139046222
1,3-diphenyl-2-[2,4,6-tris(trifluoromethyl)phenyl]-5,6-dihydro-4H-cyclopenta[c]borole (PubChem CID 139046222) has the molecular formula C56H36B2F18 and a molecular weight of 1072.49 g/mol. Its IUPAC name is 1,3-diphenyl-2-[2,4,6-tris(trifluoromethyl)phenyl]-5,6-dihydro-4H-cyclopenta[c]borole.
| Compound Name | 1,3-diphenyl-2-[2,4,6-tris(trifluoromethyl)phenyl]-5,6-dihydro-4H-cyclopenta[c]borole |
|---|---|
| PubChem CID | 139046222 |
| Molecular Formula | C56H36B2F18 |
| Molecular Weight | 1072.49 g/mol |
| Exact Mass | 1072.27 |
| IUPAC Name | 1,3-diphenyl-2-[2,4,6-tris(trifluoromethyl)phenyl]-5,6-dihydro-4H-cyclopenta[c]borole |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)c(B2C(c3ccccc3)=C3CCCC3=C2c2ccccc2)c(C(F)(F)F)c1.FC(F)(F)c1cc(C(F)(F)F)c(B2C(c3ccccc3)=C3CCCC3=C2c2ccccc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/2C28H18BF9/c2*30-26(31,32)18-14-21(27(33,34)35)25(22(15-18)28(36,37)38)29-23(16-8-3-1-4-9-16)19-12-7-13-20(19)24(29)17-10-5-2-6-11-17/h2*1-6,8-11,14-15H,7,12-13H2 |
| InChIKey | RZDLDLIAGRRDNH-UHFFFAOYSA-N |
| XLogP | 17.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1072.49 |
| LogP ≤ 5 | 17.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|