C44H22B2F24 — CID 139062233
[3,5-bis(trifluoromethyl)phenyl]-bis[2-(trifluoromethyl)phenyl]borane (PubChem CID 139062233) has the molecular formula C44H22B2F24 and a molecular weight of 1028.24 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]-bis[2-(trifluoromethyl)phenyl]borane.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]-bis[2-(trifluoromethyl)phenyl]borane |
|---|---|
| PubChem CID | 139062233 |
| Molecular Formula | C44H22B2F24 |
| Molecular Weight | 1028.24 g/mol |
| Exact Mass | 1028.15 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-bis[2-(trifluoromethyl)phenyl]borane |
| SMILES | FC(F)(F)c1cc(B(c2ccccc2C(F)(F)F)c2ccccc2C(F)(F)F)cc(C(F)(F)F)c1.FC(F)(F)c1cc(B(c2ccccc2C(F)(F)F)c2ccccc2C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/2C22H11BF12/c2*24-19(25,26)12-9-13(20(27,28)29)11-14(10-12)23(17-7-3-1-5-15(17)21(30,31)32)18-8-4-2-6-16(18)22(33,34)35/h2*1-11H |
| InChIKey | IFKQYFPOGOCUEV-UHFFFAOYSA-N |
| XLogP | 12.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1028.24 |
| LogP ≤ 5 | 12.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|