C24H16F6 — CID 23625068
1,4-bis[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]benzene (PubChem CID 23625068) has the molecular formula C24H16F6 and a molecular weight of 418.38 g/mol. Its IUPAC name is 1,4-bis[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]benzene.
| Compound Name | 1,4-bis[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 23625068 |
| Molecular Formula | C24H16F6 |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 1,4-bis[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]benzene |
| SMILES | FC(F)(F)c1cccc(/C=C/c2ccc(/C=C/c3cccc(C(F)(F)F)c3)cc2)c1 |
| InChI | InChI=1S/C24H16F6/c25-23(26,27)21-5-1-3-19(15-21)13-11-17-7-9-18(10-8-17)12-14-20-4-2-6-22(16-20)24(28,29)30/h1-16H/b13-11+,14-12+ |
| InChIKey | UQWOKXLFXDWFJH-PHEQNACWSA-N |
| XLogP | 8.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|