About 1-phenylethenyl-[2,4,6-tris(trifluoromethyl)phenyl]phosphane
1-phenylethenyl-[2,4,6-tris(trifluoromethyl)phenyl]phosphane (PubChem CID 134934615) has the molecular formula C17H10F9P
and a molecular weight of 416.22 g/mol. Its IUPAC name is 1-phenylethenyl-[2,4,6-tris(trifluoromethyl)phenyl]phosphane.
Molecular Properties
| Compound Name | 1-phenylethenyl-[2,4,6-tris(trifluoromethyl)phenyl]phosphane |
| PubChem CID | 134934615 |
| Molecular Formula | C17H10F9P |
| Molecular Weight | 416.22 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | 1-phenylethenyl-[2,4,6-tris(trifluoromethyl)phenyl]phosphane |
| SMILES | C=C(Pc1c(C(F)(F)F)cc(C(F)(F)F)cc1C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C17H10F9P/c1-9(10-5-3-2-4-6-10)27-14-12(16(21,22)23)7-11(15(18,19)20)8-13(14)17(24,25)26/h2-8,27H,1H2 |
| InChIKey | FDWZEOIEUCIDKP-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.22 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylethenyl-[2,4,6-tris(trifluoromethyl)phenyl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethenyl-[2,4,6-tris(trifluoromethyl)phenyl]phosphane?
The IUPAC name of 1-phenylethenyl-[2,4,6-tris(trifluoromethyl)phenyl]phosphane (CID 134934615) is 1-phenylethenyl-[2,4,6-tris(trifluoromethyl)phenyl]phosphane.
What is the SMILES notation for 1-phenylethenyl-[2,4,6-tris(trifluoromethyl)phenyl]phosphane?
The canonical SMILES for 1-phenylethenyl-[2,4,6-tris(trifluoromethyl)phenyl]phosphane is C=C(Pc1c(C(F)(F)F)cc(C(F)(F)F)cc1C(F)(F)F)c1ccccc1.
What is the InChIKey of 1-phenylethenyl-[2,4,6-tris(trifluoromethyl)phenyl]phosphane?
The InChIKey is FDWZEOIEUCIDKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10F9P/c1-9(10-5-3-2-4-6-10)27-14-12(16(21,22)23)7-11(15(18,19)20)8-13(14)17(24,25)26/h2-8,27H,1H2.
What are the key properties of 1-phenylethenyl-[2,4,6-tris(trifluoromethyl)phenyl]phosphane?
1-phenylethenyl-[2,4,6-tris(trifluoromethyl)phenyl]phosphane has a molecular weight of 416.22 g/mol, XLogP of 6.72, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethenyl-[2,4,6-tris(trifluoromethyl)phenyl]phosphane is sourced from PubChem (CID 134934615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).