C17H10F9P — CID 134934615
1-phenylethenyl-[2,4,6-tris(trifluoromethyl)phenyl]phosphane (PubChem CID 134934615) has the molecular formula C17H10F9P and a molecular weight of 416.22 g/mol. Its IUPAC name is 1-phenylethenyl-[2,4,6-tris(trifluoromethyl)phenyl]phosphane.
| Compound Name | 1-phenylethenyl-[2,4,6-tris(trifluoromethyl)phenyl]phosphane |
|---|---|
| PubChem CID | 134934615 |
| Molecular Formula | C17H10F9P |
| Molecular Weight | 416.22 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | 1-phenylethenyl-[2,4,6-tris(trifluoromethyl)phenyl]phosphane |
| SMILES | C=C(Pc1c(C(F)(F)F)cc(C(F)(F)F)cc1C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C17H10F9P/c1-9(10-5-3-2-4-6-10)27-14-12(16(21,22)23)7-11(15(18,19)20)8-13(14)17(24,25)26/h2-8,27H,1H2 |
| InChIKey | FDWZEOIEUCIDKP-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.22 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|