About 4,10-dimethyl-2,8-bis(trifluoromethyl)perylene
4,10-dimethyl-2,8-bis(trifluoromethyl)perylene (PubChem CID 88869821) has the molecular formula C24H14F6
and a molecular weight of 416.36 g/mol. Its IUPAC name is 4,10-dimethyl-2,8-bis(trifluoromethyl)perylene.
Molecular Properties
| Compound Name | 4,10-dimethyl-2,8-bis(trifluoromethyl)perylene |
| PubChem CID | 88869821 |
| Molecular Formula | C24H14F6 |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 4,10-dimethyl-2,8-bis(trifluoromethyl)perylene |
| SMILES | Cc1ccc2c3cc(C(F)(F)F)cc4c(C)ccc(c5cc(C(F)(F)F)cc1c25)c43 |
| InChI | InChI=1S/C24H14F6/c1-11-3-5-15-20-10-14(24(28,29)30)8-18-12(2)4-6-16(22(18)20)19-9-13(23(25,26)27)7-17(11)21(15)19/h3-10H,1-2H3 |
| InChIKey | IUGOBEWWDAZING-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 4,10-dimethyl-2,8-bis(trifluoromethyl)perylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,10-dimethyl-2,8-bis(trifluoromethyl)perylene?
The IUPAC name of 4,10-dimethyl-2,8-bis(trifluoromethyl)perylene (CID 88869821) is 4,10-dimethyl-2,8-bis(trifluoromethyl)perylene.
What is the SMILES notation for 4,10-dimethyl-2,8-bis(trifluoromethyl)perylene?
The canonical SMILES for 4,10-dimethyl-2,8-bis(trifluoromethyl)perylene is Cc1ccc2c3cc(C(F)(F)F)cc4c(C)ccc(c5cc(C(F)(F)F)cc1c25)c43.
What is the InChIKey of 4,10-dimethyl-2,8-bis(trifluoromethyl)perylene?
The InChIKey is IUGOBEWWDAZING-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H14F6/c1-11-3-5-15-20-10-14(24(28,29)30)8-18-12(2)4-6-16(22(18)20)19-9-13(23(25,26)27)7-17(11)21(15)19/h3-10H,1-2H3.
What are the key properties of 4,10-dimethyl-2,8-bis(trifluoromethyl)perylene?
4,10-dimethyl-2,8-bis(trifluoromethyl)perylene has a molecular weight of 416.36 g/mol, XLogP of 8.39, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,10-dimethyl-2,8-bis(trifluoromethyl)perylene is sourced from PubChem (CID 88869821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).