C24H14F6 — CID 88869821
4,10-dimethyl-2,8-bis(trifluoromethyl)perylene (PubChem CID 88869821) has the molecular formula C24H14F6 and a molecular weight of 416.36 g/mol. Its IUPAC name is 4,10-dimethyl-2,8-bis(trifluoromethyl)perylene.
| Compound Name | 4,10-dimethyl-2,8-bis(trifluoromethyl)perylene |
|---|---|
| PubChem CID | 88869821 |
| Molecular Formula | C24H14F6 |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 4,10-dimethyl-2,8-bis(trifluoromethyl)perylene |
| SMILES | Cc1ccc2c3cc(C(F)(F)F)cc4c(C)ccc(c5cc(C(F)(F)F)cc1c25)c43 |
| InChI | InChI=1S/C24H14F6/c1-11-3-5-15-20-10-14(24(28,29)30)8-18-12(2)4-6-16(22(18)20)19-9-13(23(25,26)27)7-17(11)21(15)19/h3-10H,1-2H3 |
| InChIKey | IUGOBEWWDAZING-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|