C24H8F18 — CID 161467485
1,5-bis[2,5-bis(trifluoromethyl)phenyl]-2,4-bis(trifluoromethyl)benzene (PubChem CID 161467485) has the molecular formula C24H8F18 and a molecular weight of 638.29 g/mol. Its IUPAC name is 1,5-bis[2,5-bis(trifluoromethyl)phenyl]-2,4-bis(trifluoromethyl)benzene.
| Compound Name | 1,5-bis[2,5-bis(trifluoromethyl)phenyl]-2,4-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 161467485 |
| Molecular Formula | C24H8F18 |
| Molecular Weight | 638.29 g/mol |
| Exact Mass | 638.03 |
| IUPAC Name | 1,5-bis[2,5-bis(trifluoromethyl)phenyl]-2,4-bis(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1ccc(C(F)(F)F)c(-c2cc(-c3cc(C(F)(F)F)ccc3C(F)(F)F)c(C(F)(F)F)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C24H8F18/c25-19(26,27)9-1-3-15(21(31,32)33)11(5-9)13-7-14(18(24(40,41)42)8-17(13)23(37,38)39)12-6-10(20(28,29)30)2-4-16(12)22(34,35)36/h1-8H |
| InChIKey | MQHBLVCBOGHSEI-UHFFFAOYSA-N |
| XLogP | 11.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.29 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |