C16H13F6NO4 — CID 19030639
diethyl 4,6-bis(trifluoromethyl)-1H-indole-2,3-dicarboxylate (PubChem CID 19030639) has the molecular formula C16H13F6NO4 and a molecular weight of 397.27 g/mol. Its IUPAC name is diethyl 4,6-bis(trifluoromethyl)-1H-indole-2,3-dicarboxylate.
| Compound Name | diethyl 4,6-bis(trifluoromethyl)-1H-indole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 19030639 |
| Molecular Formula | C16H13F6NO4 |
| Molecular Weight | 397.27 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | diethyl 4,6-bis(trifluoromethyl)-1H-indole-2,3-dicarboxylate |
| SMILES | CCOC(=O)c1[nH]c2cc(C(F)(F)F)cc(C(F)(F)F)c2c1C(=O)OCC |
| InChI | InChI=1S/C16H13F6NO4/c1-3-26-13(24)11-10-8(16(20,21)22)5-7(15(17,18)19)6-9(10)23-12(11)14(25)27-4-2/h5-6,23H,3-4H2,1-2H3 |
| InChIKey | BYOGTRFFFLIUCN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.27 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |