C18H14F3NO2 — CID 54020357
ethyl 3-[3-(trifluoromethyl)phenyl]-2H-isoindole-1-carboxylate (PubChem CID 54020357) has the molecular formula C18H14F3NO2 and a molecular weight of 333.31 g/mol. Its IUPAC name is ethyl 3-[3-(trifluoromethyl)phenyl]-2H-isoindole-1-carboxylate.
| Compound Name | ethyl 3-[3-(trifluoromethyl)phenyl]-2H-isoindole-1-carboxylate |
|---|---|
| PubChem CID | 54020357 |
| Molecular Formula | C18H14F3NO2 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | ethyl 3-[3-(trifluoromethyl)phenyl]-2H-isoindole-1-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(-c2cccc(C(F)(F)F)c2)c2ccccc12 |
| InChI | InChI=1S/C18H14F3NO2/c1-2-24-17(23)16-14-9-4-3-8-13(14)15(22-16)11-6-5-7-12(10-11)18(19,20)21/h3-10,22H,2H2,1H3 |
| InChIKey | KYMJLNPIIZATST-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |