C24H17F3O4 — CID 2715995
ethyl 5-hydroxy-2-phenyl-7-[3-(trifluoromethyl)phenyl]-1-benzofuran-3-carboxylate (PubChem CID 2715995) has the molecular formula C24H17F3O4 and a molecular weight of 426.39 g/mol. Its IUPAC name is ethyl 5-hydroxy-2-phenyl-7-[3-(trifluoromethyl)phenyl]-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 5-hydroxy-2-phenyl-7-[3-(trifluoromethyl)phenyl]-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 2715995 |
| Molecular Formula | C24H17F3O4 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | ethyl 5-hydroxy-2-phenyl-7-[3-(trifluoromethyl)phenyl]-1-benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)oc2c(-c3cccc(C(F)(F)F)c3)cc(O)cc12 |
| InChI | InChI=1S/C24H17F3O4/c1-2-30-23(29)20-19-13-17(28)12-18(15-9-6-10-16(11-15)24(25,26)27)22(19)31-21(20)14-7-4-3-5-8-14/h3-13,28H,2H2,1H3 |
| InChIKey | LZMANJHZNKDTDR-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |