C22H20F3NO4 — CID 54518861
methyl 2-[[4-hydroxy-5-phenyl-3-[3-(trifluoromethyl)phenyl]furan-2-yl]amino]butanoate (PubChem CID 54518861) has the molecular formula C22H20F3NO4 and a molecular weight of 419.40 g/mol. Its IUPAC name is methyl 2-[[4-hydroxy-5-phenyl-3-[3-(trifluoromethyl)phenyl]furan-2-yl]amino]butanoate.
| Compound Name | methyl 2-[[4-hydroxy-5-phenyl-3-[3-(trifluoromethyl)phenyl]furan-2-yl]amino]butanoate |
|---|---|
| PubChem CID | 54518861 |
| Molecular Formula | C22H20F3NO4 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | methyl 2-[[4-hydroxy-5-phenyl-3-[3-(trifluoromethyl)phenyl]furan-2-yl]amino]butanoate |
| SMILES | CCC(Nc1oc(-c2ccccc2)c(O)c1-c1cccc(C(F)(F)F)c1)C(=O)OC |
| InChI | InChI=1S/C22H20F3NO4/c1-3-16(21(28)29-2)26-20-17(14-10-7-11-15(12-14)22(23,24)25)18(27)19(30-20)13-8-5-4-6-9-13/h4-12,16,26-27H,3H2,1-2H3 |
| InChIKey | YOIPEYMQGKAUMB-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |