C18H17F3N2O2S — CID 54229522
5-(ethylsulfanylmethylamino)-2-(1H-pyrrol-3-yl)-4-[3-(trifluoromethyl)phenyl]furan-3-ol (PubChem CID 54229522) has the molecular formula C18H17F3N2O2S and a molecular weight of 382.41 g/mol. Its IUPAC name is 5-(ethylsulfanylmethylamino)-2-(1H-pyrrol-3-yl)-4-[3-(trifluoromethyl)phenyl]furan-3-ol.
| Compound Name | 5-(ethylsulfanylmethylamino)-2-(1H-pyrrol-3-yl)-4-[3-(trifluoromethyl)phenyl]furan-3-ol |
|---|---|
| PubChem CID | 54229522 |
| Molecular Formula | C18H17F3N2O2S |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 5-(ethylsulfanylmethylamino)-2-(1H-pyrrol-3-yl)-4-[3-(trifluoromethyl)phenyl]furan-3-ol |
| SMILES | CCSCNc1oc(-c2cc[nH]c2)c(O)c1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H17F3N2O2S/c1-2-26-10-23-17-14(11-4-3-5-13(8-11)18(19,20)21)15(24)16(25-17)12-6-7-22-9-12/h3-9,22-24H,2,10H2,1H3 |
| InChIKey | QIGGFXOOJXCFKM-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 61.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|