C18H19F3N2O2S — CID 70452783
2-(2,3-dihydro-1H-pyrrol-4-yl)-5-(ethylsulfanylmethylamino)-4-[3-(trifluoromethyl)phenyl]furan-3-one (PubChem CID 70452783) has the molecular formula C18H19F3N2O2S and a molecular weight of 384.42 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-pyrrol-4-yl)-5-(ethylsulfanylmethylamino)-4-[3-(trifluoromethyl)phenyl]furan-3-one.
| Compound Name | 2-(2,3-dihydro-1H-pyrrol-4-yl)-5-(ethylsulfanylmethylamino)-4-[3-(trifluoromethyl)phenyl]furan-3-one |
|---|---|
| PubChem CID | 70452783 |
| Molecular Formula | C18H19F3N2O2S |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 2-(2,3-dihydro-1H-pyrrol-4-yl)-5-(ethylsulfanylmethylamino)-4-[3-(trifluoromethyl)phenyl]furan-3-one |
| SMILES | CCSCNC1=C(c2cccc(C(F)(F)F)c2)C(=O)C(C2=CNCC2)O1 |
| InChI | InChI=1S/C18H19F3N2O2S/c1-2-26-10-23-17-14(11-4-3-5-13(8-11)18(19,20)21)15(24)16(25-17)12-6-7-22-9-12/h3-5,8-9,16,22-23H,2,6-7,10H2,1H3 |
| InChIKey | RJNSQZVYWKBESS-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|