C17H18F3NO2S2 — CID 70441327
2-(ethoxymethylidene)-5-(ethylsulfanylmethylamino)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one (PubChem CID 70441327) has the molecular formula C17H18F3NO2S2 and a molecular weight of 389.46 g/mol. Its IUPAC name is 2-(ethoxymethylidene)-5-(ethylsulfanylmethylamino)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one.
| Compound Name | 2-(ethoxymethylidene)-5-(ethylsulfanylmethylamino)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one |
|---|---|
| PubChem CID | 70441327 |
| Molecular Formula | C17H18F3NO2S2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 2-(ethoxymethylidene)-5-(ethylsulfanylmethylamino)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one |
| SMILES | CCOC=C1SC(NCSCC)=C(c2cccc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C17H18F3NO2S2/c1-3-23-9-13-15(22)14(16(25-13)21-10-24-4-2)11-6-5-7-12(8-11)17(18,19)20/h5-9,21H,3-4,10H2,1-2H3 |
| InChIKey | TZWSBKFMLQJKMO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|