C18H20F3NOS3 — CID 70426065
5-[2-ethylsulfanylethyl(methyl)amino]-2-(methylsulfanylmethylidene)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one (PubChem CID 70426065) has the molecular formula C18H20F3NOS3 and a molecular weight of 419.56 g/mol. Its IUPAC name is 5-[2-ethylsulfanylethyl(methyl)amino]-2-(methylsulfanylmethylidene)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one.
| Compound Name | 5-[2-ethylsulfanylethyl(methyl)amino]-2-(methylsulfanylmethylidene)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one |
|---|---|
| PubChem CID | 70426065 |
| Molecular Formula | C18H20F3NOS3 |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 5-[2-ethylsulfanylethyl(methyl)amino]-2-(methylsulfanylmethylidene)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one |
| SMILES | CCSCCN(C)C1=C(c2cccc(C(F)(F)F)c2)C(=O)C(=CSC)S1 |
| InChI | InChI=1S/C18H20F3NOS3/c1-4-25-9-8-22(2)17-15(16(23)14(26-17)11-24-3)12-6-5-7-13(10-12)18(19,20)21/h5-7,10-11H,4,8-9H2,1-3H3 |
| InChIKey | OEOFURMDUONDDH-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|