C18H14F3NO2 — CID 138402746
5-[deuterio(methyl)amino]-2-phenyl-4-[3-(trifluoromethyl)phenyl]furan-3-one (PubChem CID 138402746) has the molecular formula C18H14F3NO2 and a molecular weight of 334.32 g/mol. Its IUPAC name is 5-[deuterio(methyl)amino]-2-phenyl-4-[3-(trifluoromethyl)phenyl]furan-3-one.
| Compound Name | 5-[deuterio(methyl)amino]-2-phenyl-4-[3-(trifluoromethyl)phenyl]furan-3-one |
|---|---|
| PubChem CID | 138402746 |
| Molecular Formula | C18H14F3NO2 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 5-[deuterio(methyl)amino]-2-phenyl-4-[3-(trifluoromethyl)phenyl]furan-3-one |
| SMILES | [2H]N(C)C1=C(c2cccc(C(F)(F)F)c2)C(=O)C(c2ccccc2)O1 |
| InChI | InChI=1S/C18H14F3NO2/c1-22-17-14(12-8-5-9-13(10-12)18(19,20)21)15(23)16(24-17)11-6-3-2-4-7-11/h2-10,16,22H,1H3/i/hD |
| InChIKey | NYRMIJKDBAQCHC-DYCDLGHISA-N |
| XLogP | 3.93 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |