C23H16O6 — CID 24774597
ethyl 1,8-dioxo-3,6-diphenylpyrano[3,4-c]pyran-4-carboxylate (PubChem CID 24774597) has the molecular formula C23H16O6 and a molecular weight of 388.38 g/mol. Its IUPAC name is ethyl 1,8-dioxo-3,6-diphenylpyrano[3,4-c]pyran-4-carboxylate.
| Compound Name | ethyl 1,8-dioxo-3,6-diphenylpyrano[3,4-c]pyran-4-carboxylate |
|---|---|
| PubChem CID | 24774597 |
| Molecular Formula | C23H16O6 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | ethyl 1,8-dioxo-3,6-diphenylpyrano[3,4-c]pyran-4-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)oc(=O)c2c(=O)oc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C23H16O6/c1-2-27-21(24)18-16-13-17(14-9-5-3-6-10-14)28-22(25)19(16)23(26)29-20(18)15-11-7-4-8-12-15/h3-13H,2H2,1H3 |
| InChIKey | USZKGXXUPWWVGM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 86.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |