C21H14O5 — CID 822829
ethyl 4,9-dioxo-2-phenylbenzo[f][1]benzofuran-3-carboxylate (PubChem CID 822829) has the molecular formula C21H14O5 and a molecular weight of 346.34 g/mol. Its IUPAC name is ethyl 4,9-dioxo-2-phenylbenzo[f][1]benzofuran-3-carboxylate.
| Compound Name | ethyl 4,9-dioxo-2-phenylbenzo[f][1]benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 822829 |
| Molecular Formula | C21H14O5 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | ethyl 4,9-dioxo-2-phenylbenzo[f][1]benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)oc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H14O5/c1-2-25-21(24)16-15-17(22)13-10-6-7-11-14(13)18(23)20(15)26-19(16)12-8-4-3-5-9-12/h3-11H,2H2,1H3 |
| InChIKey | KUAHQNZYBKFZDR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|