C15H11NO5 — CID 14895315
ethyl 2-methyl-4,9-dioxofuro[3,2-g]quinoline-3-carboxylate (PubChem CID 14895315) has the molecular formula C15H11NO5 and a molecular weight of 285.26 g/mol. Its IUPAC name is ethyl 2-methyl-4,9-dioxofuro[3,2-g]quinoline-3-carboxylate.
| Compound Name | ethyl 2-methyl-4,9-dioxofuro[3,2-g]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 14895315 |
| Molecular Formula | C15H11NO5 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | ethyl 2-methyl-4,9-dioxofuro[3,2-g]quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc2c1C(=O)c1cccnc1C2=O |
| InChI | InChI=1S/C15H11NO5/c1-3-20-15(19)9-7(2)21-14-10(9)12(17)8-5-4-6-16-11(8)13(14)18/h4-6H,3H2,1-2H3 |
| InChIKey | DOQJAKRLELECTO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 86.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|