C22H16N2O4 — CID 11280197
ethyl 9-(4-methylphenyl)-5,10-dioxopyrido[4,3-g]quinoline-7-carboxylate (PubChem CID 11280197) has the molecular formula C22H16N2O4 and a molecular weight of 372.38 g/mol. Its IUPAC name is ethyl 9-(4-methylphenyl)-5,10-dioxopyrido[4,3-g]quinoline-7-carboxylate.
| Compound Name | ethyl 9-(4-methylphenyl)-5,10-dioxopyrido[4,3-g]quinoline-7-carboxylate |
|---|---|
| PubChem CID | 11280197 |
| Molecular Formula | C22H16N2O4 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | ethyl 9-(4-methylphenyl)-5,10-dioxopyrido[4,3-g]quinoline-7-carboxylate |
| SMILES | CCOC(=O)c1cc2c(c(-c3ccc(C)cc3)n1)C(=O)c1ncccc1C2=O |
| InChI | InChI=1S/C22H16N2O4/c1-3-28-22(27)16-11-15-17(18(24-16)13-8-6-12(2)7-9-13)21(26)19-14(20(15)25)5-4-10-23-19/h4-11H,3H2,1-2H3 |
| InChIKey | RXFHCPZRGRCDRR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 86.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|